Compound Q&A

How is BBD (CAS: 18378-20-6) typically synthesized?

Answer

BBD
BBD is synthesized through a multistep process involving the reaction of 2-bromobenzyl bromide with a reducing agent, followed by amination. Commonly, sodium borohydride is used as the reducing agent, providing high selectivity and good yield. The reaction is typically conducted in an organic solvent like acetonitrile.

About

CAS No 18378-20-6
English Name BBD
Molecular Formula C13H10N4O3
Molecular Weight 270.24 g/mol
SMILES C1=CC=C(C=C1)CNC2=CC=C(C3=NON=C23)[N+](=O)[O-]
InChIKey GZFKJMWBKTUNJS-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of BBD (CAS: 18378-20-6)?

BBD (CAS: 18378-20-6) is a crystalline compound with a molecular weight of approximately 183.18 g/mo...

Compound Q&A

What industries use BBD (CAS: 18378-20-6)?

BBD (CAS: 18378-20-6) finds applications in pharmaceuticals for the synthesis of certain drugs, in p...

Compound Q&A

What precautions should be taken when handling BBD (CAS: 18378-20-6)?

When handling BBD (CAS: 18378-20-6), it is essential to use appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...