Compound Q&A

How is 4-Cyclopropyl-1-naphthalenamine hydrochloride (CAS: 1533519-92-4) typically synthesized?

Answer

4-Cyclopropyl-1-naphthalenamine hydrochloride (1:1)
4-Cyclopropyl-1-naphthalenamine hydrochloride can be synthesized through the reaction of 1-naphthalenamine with cyclopropyl bromide in the presence of a base, such as sodium hydride. The yield is generally good, and the product can be purified by recrystallization from an appropriate solvent. The reaction is usually conducted under an inert atmosphere to prevent side reactions.

About

English Name 4-Cyclopropyl-1-naphthalenamine hydrochloride (1:1)
Molecular Formula C13H14ClN
Molecular Weight 219.71 g/mol
SMILES c1ccc2c(c1)c(ccc2N)C3CC3.Cl
InChIKey CIQWZUGROQAMOL-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Cyclopropyl-1-naphthalenamine hydrochloride (CAS: 1533519-92-4)?

4-Cyclopropyl-1-naphthalenamine hydrochloride is a crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use 4-Cyclopropyl-1-naphthalenamine hydrochloride (CAS: 1533519-92-4)?

4-Cyclopropyl-1-naphthalenamine hydrochloride is used in the pharmaceutical industry as a precursor ...

Compound Q&A

What precautions should be taken when handling 4-Cyclopropyl-1-naphthalenamine hydrochloride (CAS: 1533519-92-4)?

When handling 4-Cyclopropyl-1-naphthalenamine hydrochloride, it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...