Compound Q&A

How should (3,4-Dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone (CAS: 134308-13-7) be stored?

Answer

(3,4-Dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone
(3,4-Dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone should be stored in a cool, dry place away from direct sunlight and sources of ignition. It should be kept in a tightly sealed container to prevent exposure to air and moisture. The storage temperature should be below 25°C (77°F) to ensure stability and safety.

About

English Name (3,4-Dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone
Molecular Formula C14H11NO5
Molecular Weight 273.24 g/mol
SMILES CC1=CC=C(C=C1)C(=O)C2=CC(=C(C(=C2)O)O)[N+](=O)[O-]
InChIKey MIQPIUSUKVNLNT-UHFFFAOYSA-N
Last Updated: 2025-10-03 16:48

Related Q&A

Compound Q&A

What is (3,4-Dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone (CAS: 134308-13-7)?

(3,4-Dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone is a chemical compound with the CAS number 13...

Compound Q&A

What are the main uses of (3,4-Dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone (CAS: 134308-13-7)?

(3,4-Dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone is primarily used in organic synthesis and as...

Compound Q&A

Is (3,4-Dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone (CAS: 134308-13-7) safe?

(3,4-Dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone is generally safe when handled with appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...