Compound Q&A

Is 4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid (CAS: 18720-35-9) safe?

Answer

4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid
4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid is generally considered safe when handled properly. However, it should be used with caution due to its chemical nature. Proper protective equipment, such as gloves and goggles, should be worn, and appropriate ventilation should be maintained. Ingestion or skin contact should be avoided.

About

CAS No 18720-35-9
English Name 4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid
Molecular Formula C11H16O4
Molecular Weight 212.24 g/mol
SMILES COC(=O)C12CCC(CC1)(CC2)C(=O)O
InChIKey KBZVAQVEHVGIEI-UHFFFAOYSA-N
Last Updated: 2025-10-03 16:47

Related Q&A

Compound Q&A

What is 4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid (CAS: 18720-35-9)?

4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid is a cyclic carboxylic acid with a methoxy...

Compound Q&A

What are the main uses of 4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid (CAS: 18720-35-9)?

4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid is primarily used in pharmaceutical and ch...

Compound Q&A

How should 4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid (CAS: 18720-35-9) be stored?

4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid should be stored in a cool, dry place away...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...