Compound Q&A

Are there alternatives to 2,7-Dibromotriphenylene (CAS: 888041-37-0) in synthesis?

Answer

2,7-Dibromotriphenylene
There are several alternatives to 2,7-Dibromotriphenylene in synthesis. For example, 2,7-Dichlorotriphenylene and 2,7-Difluorotriphenylene can be used as similar compounds. Additionally, other brominated derivatives or non-brominated aromatic compounds might serve as viable alternatives depending on the specific reaction conditions and desired product properties.

About

English Name 2,7-Dibromotriphenylene
Molecular Formula C18H10Br2
Molecular Weight 386.0860000000001 g/mol
SMILES C1=CC=C2C(=C1)C3=C(C=CC(=C3)Br)C4=C2C=C(C=C4)Br
InChIKey BPGPBYGXGRDFQG-UHFFFAOYSA-N
Last Updated: 2025-10-03 07:50

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,7-Dibromotriphenylene (CAS: 888041-37-0)?

2,7-Dibromotriphenylene (CAS: 888041-37-0) is subject to various regulatory guidelines. Under the Gl...

Compound Q&A

What is the market or research trend for 2,7-Dibromotriphenylene (CAS: 888041-37-0)?

The market and research trends for 2,7-Dibromotriphenylene (CAS: 888041-37-0) are focused on its pot...

Compound Q&A

How should waste containing 2,7-Dibromotriphenylene (CAS: 888041-37-0) be handled?

Waste containing 2,7-Dibromotriphenylene (CAS: 888041-37-0) should be managed according to hazardous...

Compound Q&A

Is 2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) safe?

2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) is generally considered safe whe...

94045-97-32-Nitro-3,5,6-trimet...
Compound Q&A

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside is a complex or...

17691-02-04-Aminophenyl 4-O-be...
Compound Q&A

What precautions should be taken when handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9)?

When handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9), it is imp...

1060801-39-93-bromo-N,N-dimethyl...
Compound Q&A

How should waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) be handled?

Waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) shoul...

607371-03-95-Bromo-N~4~-ethyl-3...