Compound Q&A

Are there alternatives to N-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt in synthesis?

Answer

N-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt
There are alternative reagents that can be used in synthesis depending on the specific application. For instance, similar compounds like N-(2-hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline or other aniline derivatives can serve as alternatives. However, the choice of alternative depends on the desired properties and the reaction conditions.

About

CAS No 83777-30-4
English Name N-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt
Molecular Formula C13H20NNaO6S
Molecular Weight 341.36 g/mol
SMILES CCN(CC(CS(=O)(=O)[O-])O)C1=CC(=CC(=C1)OC)OC.[Na+]
InChIKey HDARHUHTZKLJET-UHFFFAOYSA-M
Last Updated: 2025-10-03 07:50

Related Q&A

Compound Q&A

What regulatory guidelines apply to N-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt (CAS: 83777-30-4)?

N-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt (CAS: 83777-30-4) is regulated ...

Compound Q&A

What is the market or research trend for N-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt?

The market for N-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt is growing due t...

Compound Q&A

How should waste containing N-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt be handled?

Waste containing N-Ethyl-n-(2-hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt (CAS: 83777-30...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...