Compound Q&A

What are the physical and chemical properties of Tris(2-chloropropyl) phosphate (CAS: 6145-73-9)?

Answer

Tris(2-chloropropyl) phosphate
Tris(2-chloropropyl) phosphate (CAS: 6145-73-9) is a clear to slightly yellow liquid with a molecular weight of approximately 335.11 g/mol. It has a low solubility in water (less than 1% at 20°C) but is soluble in organic solvents. This compound is chemically reactive, particularly towards nucleophiles and reducing agents, making it a useful flame retardant and plasticizer in various applications.

About

CAS No 6145-73-9
English Name Tris(2-chloropropyl) phosphate
Molecular Formula C9H18Cl3O4P
Molecular Weight 327.57 g/mol
SMILES CC(COP(=O)(OCC(C)Cl)OCC(C)Cl)Cl
InChIKey GTRSAMFYSUBAGN-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is Tris(2-chloropropyl) phosphate (CAS: 6145-73-9) typically synthesized?

Tris(2-chloropropyl) phosphate (CAS: 6145-73-9) is typically synthesized through the reaction of 2-c...

Compound Q&A

What industries use Tris(2-chloropropyl) phosphate (CAS: 6145-73-9)?

Tris(2-chloropropyl) phosphate (CAS: 6145-73-9) is widely used in the polymer and plastic industries...

Compound Q&A

What precautions should be taken when handling Tris(2-chloropropyl) phosphate (CAS: 6145-73-9)?

When handling Tris(2-chloropropyl) phosphate (CAS: 6145-73-9), it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...