Compound Q&A

What are the physical and chemical properties of (3-endo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl (2S)-3-hydroxy-2-phenylpropanoate sulfate (2:1) (CAS: 620-61-1)?

Answer

(3-endo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl (2S)-3-hydroxy-2-phenylpropanoate sulfate (2:1)
The compound has a crystalline form and a molecular weight of approximately 413.4 g/mol. It is moderately soluble in water and has limited solubility in organic solvents. Chemically, it is reactive towards strong bases and can undergo ester hydrolysis under basic conditions. It is also susceptible to oxidation and reduction reactions.

About

CAS No 620-61-1
English Name (3-endo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl (2S)-3-hydroxy-2-phenylpropanoate sulfate (2:1)
Molecular Formula C34H48N2O10S
Molecular Weight 676.83 g/mol
SMILES CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)[C@H](CO)C3=CC=CC=C3.CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)[C@H](CO)C3=CC=CC=C3.OS(=O)(=O)O
InChIKey HOBWAPHTEJGALG-XHJLRQJWSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is (3-endo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl (2S)-3-hydroxy-2-phenylpropanoate sulfate (2:1) (CAS: 620-61-1) typically synthesized?

The compound is typically synthesized through a multi-step process involving the condensation of an ...

Compound Q&A

What industries use (3-endo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl (2S)-3-hydroxy-2-phenylpropanoate sulfate (2:1) (CAS: 620-61-1)?

This compound is primarily used in the pharmaceutical industry as an intermediate or precursor for t...

Compound Q&A

What precautions should be taken when handling (3-endo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl (2S)-3-hydroxy-2-phenylpropanoate sulfate (2:1) (CAS: 620-61-1)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...