Compound Q&A

How is 2-(2H-Benzotriazol-2-yl)-6-[3-(1,1,1,3,5,5,5-heptamethyl-3-trisiloxanyl)-2-methylpropyl]-4-methylphenol (CAS: 155633-54-8) typically synthesized?

Answer

2-(2H-Benzotriazol-2-yl)-6-[3-(1,1,1,3,5,5,5-heptamethyl-3-trisiloxanyl)-2-methylpropyl]-4-methylphenol
This compound can be synthesized via a multistep approach involving the protection of a phenol group, introduction of a benzotriazole moiety, followed by trisiloxane and methyl group modifications. Common reagents include benzotriazolyl chlorides, silanes, and methyl halides. Specific conditions such as temperature, solvent, and catalysts (e.g., phosphine ligands) are crucial for achieving high yield and selectivity.

About

English Name 2-(2H-Benzotriazol-2-yl)-6-[3-(1,1,1,3,5,5,5-heptamethyl-3-trisiloxanyl)-2-methylpropyl]-4-methylphenol
Molecular Formula C24H39N3O3Si3
Molecular Weight 501.85 g/mol
SMILES CC(Cc1cc(C)cc(c1O)n2nc3ccccc3n2)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C
InChIKey HUVYTMDMDZRHBN-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2H-Benzotriazol-2-yl)-6-[3-(1,1,1,3,5,5,5-heptamethyl-3-trisiloxanyl)-2-methylpropyl]-4-methylphenol (CAS: 155633-54-8)?

This compound is a white crystalline solid with a high molecular weight. It has low solubility in wa...

Compound Q&A

What industries use 2-(2H-Benzotriazol-2-yl)-6-[3-(1,1,1,3,5,5,5-heptamethyl-3-trisiloxanyl)-2-methylpropyl]-4-methylphenol (CAS: 155633-54-8)?

This compound is primarily used in the pharmaceutical industry for its antioxidant and photostabiliz...

Compound Q&A

What precautions should be taken when handling 2-(2H-Benzotriazol-2-yl)-6-[3-(1,1,1,3,5,5,5-heptamethyl-3-trisiloxanyl)-2-methylpropyl]-4-methylphenol (CAS: 155633-54-8)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...