Compound Q&A

How is 2,5-Diaminoterephthalic acid (CAS: 945-30-2) typically synthesized?

Answer

2,5-Diaminoterephthalic acid
2,5-Diaminoterephthalic acid is typically synthesized via the amino-tungstic acid route, involving the reaction of tungstic acid with primary amines. This process yields the target compound with good selectivity and moderate to high yield.

About

CAS No 945-30-2
English Name 2,5-Diaminoterephthalic acid
Molecular Formula C8H8N2O4
Molecular Weight 196.16 g/mol
SMILES C1=C(C(=CC(=C1N)C(=O)O)N)C(=O)O
InChIKey WIOZZYWDYUOMAY-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Diaminoterephthalic acid (CAS: 945-30-2)?

2,5-Diaminoterephthalic acid (2,5-DiA) is a white crystalline solid with a molecular weight of 196.1...

Compound Q&A

What industries use 2,5-Diaminoterephthalic acid (CAS: 945-30-2)?

2,5-Diaminoterephthalic acid finds applications in the pharmaceutical and polymer industries. It is ...

Compound Q&A

What precautions should be taken when handling 2,5-Diaminoterephthalic acid (CAS: 945-30-2)?

When handling 2,5-Diaminoterephthalic acid, it is essential to use personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...