Compound Q&A

How is 3-Benzylbenzonitrile (CAS: 93717-55-6) typically synthesized?

Answer

3-Benzylbenzonitrile
3-Benzylbenzonitrile is commonly synthesized via the nitrilation of benzyltoluene with sodium hydroxide in water. Alternatively, it can be prepared by reacting benzyl alcohol with acetonitrile in the presence of a base such as sodium hydroxide. The yield is generally high, and the reaction is relatively simple but requires the use of appropriate safety measures and equipment

About

CAS No 93717-55-6
English Name 3-Benzylbenzonitrile
Molecular Formula C14H11N
Molecular Weight 182.27 g/mol
SMILES C1=CC=C(C=C1)CC2=CC(=CC=C2)C#N
InChIKey ZGQVZLSNEBEHFN-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Benzylbenzonitrile (CAS: 93717-55-6)?

3-Benzylbenzonitrile (CAS: 93717-55-6) is a colorless to pale yellow liquid with a pungent odor. Its...

Compound Q&A

What industries use 3-Benzylbenzonitrile (CAS: 93717-55-6)?

3-Benzylbenzonitrile (CAS: 93717-55-6) is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling 3-Benzylbenzonitrile (CAS: 93717-55-6)?

When handling 3-Benzylbenzonitrile (CAS: 93717-55-6), always wear personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...