Compound Q&A

How is 2,6-Difluoro-3-nitrobenzoic acid (CAS: 83141-10-0) typically synthesized?

Answer

2,6-Difluoro-3-nitrobenzoic acid
2,6-Difluoro-3-nitrobenzoic acid is commonly synthesized by the nitration of 2,6-difluorobenzoic acid. This involves reacting the starting material with a mixture of nitric and sulfuric acids. The process yields a mixture that requires recrystallization to obtain pure 2,6-difluoro-3-nitrobenzoic acid, with good selectivity and a yield typically around 70-80%.

About

CAS No 83141-10-0
English Name 2,6-Difluoro-3-nitrobenzoic acid
Molecular Formula C7H3F2NO4
Molecular Weight 203.0998 g/mol
SMILES OC(=O)c1c(F)ccc([N+](=O)[O-])c1F
InChIKey PDDHSNODMFIIRV-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Difluoro-3-nitrobenzoic acid (CAS: 83141-10-0)?

2,6-Difluoro-3-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 217...

Compound Q&A

What industries use 2,6-Difluoro-3-nitrobenzoic acid (CAS: 83141-10-0)?

2,6-Difluoro-3-nitrobenzoic acid finds applications in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 2,6-Difluoro-3-nitrobenzoic acid (CAS: 83141-10-0)?

When handling 2,6-Difluoro-3-nitrobenzoic acid, it is important to use appropriate personal protecti...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...