Compound Q&A

How is 2,6-Difluoro-3-nitrobenzoic acid (CAS: 83141-10-0) typically synthesized?

Answer

2,6-Difluoro-3-nitrobenzoic acid
2,6-Difluoro-3-nitrobenzoic acid is commonly synthesized by the nitration of 2,6-difluorobenzoic acid. This involves reacting the starting material with a mixture of nitric and sulfuric acids. The process yields a mixture that requires recrystallization to obtain pure 2,6-difluoro-3-nitrobenzoic acid, with good selectivity and a yield typically around 70-80%.

About

CAS No 83141-10-0
English Name 2,6-Difluoro-3-nitrobenzoic acid
Molecular Formula C7H3F2NO4
Molecular Weight 203.1 g/mol
SMILES OC(=O)c1c(F)ccc([N+](=O)[O-])c1F
InChIKey PDDHSNODMFIIRV-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Difluoro-3-nitrobenzoic acid (CAS: 83141-10-0)?

2,6-Difluoro-3-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 217...

Compound Q&A

What industries use 2,6-Difluoro-3-nitrobenzoic acid (CAS: 83141-10-0)?

2,6-Difluoro-3-nitrobenzoic acid finds applications in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 2,6-Difluoro-3-nitrobenzoic acid (CAS: 83141-10-0)?

When handling 2,6-Difluoro-3-nitrobenzoic acid, it is important to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...