Compound Q&A

What are the physical and chemical properties of AS-605240 (CAS: 648450-29-7)?

Answer

AS-605240
AS-605240 is a crystalline compound with a molecular weight of approximately 411.36 g/mol. It has a solubility of up to 1 mg/mL in water and is generally stable under standard storage conditions. It reacts readily with reducing agents and strong bases. The compound has a melting point of 175-177°C and a boiling point of 280-300°C under reduced pressure.

About

English Name AS-605240
Molecular Formula C12H7N3O2S
Molecular Weight 257.27 g/mol
SMILES C1=CC2=NC=CN=C2C=C1C=C3C(=O)NC(=O)S3
InChIKey SQWZFLMPDUSYGV-UXBLZVDNSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is AS-605240 (CAS: 648450-29-7) typically synthesized?

AS-605240 is typically synthesized via a multi-step route involving condensation, reduction, and dep...

Compound Q&A

What industries use AS-605240 (CAS: 648450-29-7)?

AS-605240 is primarily used in the pharmaceutical industry for its potential as an investigational d...

Compound Q&A

What precautions should be taken when handling AS-605240 (CAS: 648450-29-7)?

When handling AS-605240, appropriate personal protective equipment (PPE) such as gloves, goggles, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...