Compound Q&A

What industries use 2-Amino-6-ethoxybenzothiazole (CAS: 94-45-1)?

Answer

2-Amino-6-ethoxybenzothiazole
2-Amino-6-ethoxybenzothiazole (CAS: 94-45-1) is used in various industries such as pharmaceuticals, where it serves as a precursor to active pharmaceutical ingredients (APIs). In the polymer industry, it is used as a stabilizer. It also finds applications in the production of sensors and semiconductors due to its reactivity and functional groups. Additionally, it is utilized in the development of organic dyes and as a precursor in the synthesis of other heterocyclic compounds.

About

CAS No 94-45-1
English Name 2-Amino-6-ethoxybenzothiazole
Molecular Formula C9H10N2OS
Molecular Weight 194.26 g/mol
SMILES CCOC1=CC2=C(C=C1)N=C(S2)N
InChIKey KOYJWFGMEBETBU-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-6-ethoxybenzothiazole (CAS: 94-45-1)?

2-Amino-6-ethoxybenzothiazole (CAS: 94-45-1) is a white to off-white crystalline solid with a high m...

Compound Q&A

How is 2-Amino-6-ethoxybenzothiazole (CAS: 94-45-1) typically synthesized?

2-Amino-6-ethoxybenzothiazole (CAS: 94-45-1) is typically synthesized via the reaction of 6-ethoxybe...

Compound Q&A

What precautions should be taken when handling 2-Amino-6-ethoxybenzothiazole (CAS: 94-45-1)?

When handling 2-Amino-6-ethoxybenzothiazole (CAS: 94-45-1), it is crucial to use proper personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...