Compound Q&A

What precautions should be taken when handling 4-(4-Bromo-3-formylphenoxy)benzonitrile (CAS: 906673-54-9)?

Answer

4-(4-Bromo-3-formylphenoxy)benzonitrile
When handling 4-(4-Bromo-3-formylphenoxy)benzonitrile, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. In case of a spill, neutralize with an appropriate base and dispose of according to local regulations. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

English Name 4-(4-Bromo-3-formylphenoxy)benzonitrile
Molecular Formula C14H8BrNO2
Molecular Weight 291.14 g/mol
SMILES C1=CC(=CC=C1C#N)OC2=CC(=C(C=C2)Br)C=O
InChIKey IEHZPKWXBVTRRG-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Bromo-3-formylphenoxy)benzonitrile (CAS: 906673-54-9)?

4-(4-Bromo-3-formylphenoxy)benzonitrile is a crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 4-(4-Bromo-3-formylphenoxy)benzonitrile (CAS: 906673-54-9) typically synthesized?

4-(4-Bromo-3-formylphenoxy)benzonitrile is typically synthesized via the reaction of 4-bromophenol w...

Compound Q&A

What industries use 4-(4-Bromo-3-formylphenoxy)benzonitrile (CAS: 906673-54-9)?

4-(4-Bromo-3-formylphenoxy)benzonitrile is primarily used in the pharmaceutical and chemical industr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...