Compound Q&A

How is tetraethylammonium sulfate (CAS: 16873-13-5) typically synthesized?

Answer

tetraethylammonium sulfate
Tetraethylammonium sulfate is typically synthesized by reacting tetraethylammonium hydroxide with sulfuric acid. The reaction is carried out in an aqueous medium at room temperature. The product is usually isolated by filtration and washed with water to remove any unreacted starting materials. The yield is generally high, and the product is pure upon recrystallization from water.

About

CAS No 16873-13-5
English Name tetraethylammonium sulfate
Molecular Formula C8H20NO4S
Molecular Weight 227.32 g/mol
SMILES CC[N+](CC)(CC)CC.OS(=O)(=O)[O-]
InChIKey CREVBWLEPKAZBH-UHFFFAOYSA-L
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of tetraethylammonium sulfate (CAS: 16873-13-5)?

Tetraethylammonium sulfate (CAS: 16873-13-5) is a colorless or white crystalline solid. It has a mol...

Compound Q&A

What industries use tetraethylammonium sulfate (CAS: 16873-13-5)?

Tetraethylammonium sulfate (CAS: 16873-13-5) is used in various industries, including pharmaceutical...

Compound Q&A

What precautions should be taken when handling tetraethylammonium sulfate (CAS: 16873-13-5)?

When handling tetraethylammonium sulfate (CAS: 16873-13-5), it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...