Compound Q&A

How is 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1) typically synthesized?

Answer

2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride
2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1) is typically synthesized through the reaction of 2-(methacryloyloxy)ethyltrimethylammonium chloride with hydrochloric acid. The reaction involves the protonation of the amine group, resulting in the formation of the chloride salt. Commonly, this reaction is carried out under mild conditions, and the product is isolated by filtration and recrystallization.

About

CAS No 26161-33-1
English Name 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride
Molecular Formula C9H18ClNO2
Molecular Weight 207.7 g/mol
SMILES CC(=C)C(=O)OCC[N+](C)(C)C.[Cl-]
InChIKey RRHXZLALVWBDKH-UHFFFAOYSA-M
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1)?

2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1) is a white crystalline so...

Compound Q&A

What industries use 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1)?

2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1) is used in various indust...

Compound Q&A

What precautions should be taken when handling 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1)?

When handling 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1), it is impo...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...