Compound Q&A

What are the physical and chemical properties of 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1)?

Answer

2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride
2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1) is a white crystalline solid with a molecular weight of approximately 271.38 g/mol. It has a pKa of approximately 7.5, making it slightly basic. The compound is soluble in water and organic solvents. It is reactive due to the presence of the methacryloyloxy group, which can participate in various chemical reactions such as polymerization and esterification.

About

CAS No 26161-33-1
English Name 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride
Molecular Formula C9H18ClNO2
Molecular Weight 207.7 g/mol
SMILES CC(=C)C(=O)OCC[N+](C)(C)C.[Cl-]
InChIKey RRHXZLALVWBDKH-UHFFFAOYSA-M
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1) typically synthesized?

2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1) is typically synthesized ...

Compound Q&A

What industries use 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1)?

2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1) is used in various indust...

Compound Q&A

What precautions should be taken when handling 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1)?

When handling 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium chloride (CAS: 26161-33-1), it is impo...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...