Compound Q&A

What industries use l-Glutamic acid, N-cocoacylderivs., monosodium salts (CAS: 68187-32-6)?

Answer

l-Glutamicacid,N-cocoacylderivs.,monosodiumsalts
l-Glutamic acid, N-cocoacylderivs., monosodium salts are used in various industries including pharmaceuticals for the production of certain drug intermediates, in polymers for functionalization of polymer surfaces, in sensors for specific chemical detection, and in semiconductors for surface modification processes.

About

CAS No 68187-32-6
English Name l-Glutamicacid,N-cocoacylderivs.,monosodiumsalts
Molecular Formula C5H7NNa2O4
Molecular Weight 191.09 g/mol
SMILES C(CC(=O)[O-])C(C(=O)[O-])N.[Na+].[Na+]
InChIKey PXEDJBXQKAGXNJ-UHFFFAOYSA-L
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of l-Glutamic acid, N-cocoacylderivs., monosodium salts (CAS: 68187-32-6)?

l-Glutamic acid, N-cocoacylderivs., monosodium salts have a crystalline form with a molecular weight...

Compound Q&A

How is l-Glutamic acid, N-cocoacylderivs., monosodium salts (CAS: 68187-32-6) typically synthesized?

l-Glutamic acid, N-cocoacylderivs., monosodium salts are typically synthesized through the esterific...

Compound Q&A

What precautions should be taken when handling l-Glutamic acid, N-cocoacylderivs., monosodium salts (CAS: 68187-32-6)?

When handling l-Glutamic acid, N-cocoacylderivs., monosodium salts, appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...