Compound Q&A

What are the physical and chemical properties of Stiripentol (CAS: 49763-96-4)?

Answer

Stiripentol
Stiripentol (CAS: 49763-96-4) is a white crystalline solid with a molecular weight of approximately 292.33 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol. Stiripentol is known for its low reactivity, making it stable under normal conditions. It has a melting point of about 192-195°C and is relatively stable to heat and light.

About

CAS No 49763-96-4
English Name Stiripentol
Molecular Formula C14H18O3
Molecular Weight 234.29 g/mol
SMILES CC(C)(C)C(C=CC1=CC2=C(C=C1)OCO2)O
InChIKey IBLNKMRFIPWSOY-FNORWQNLSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is Stiripentol (CAS: 49763-96-4) typically synthesized?

Stiripentol (CAS: 49763-96-4) is typically synthesized through a multi-step process involving alkyla...

Compound Q&A

What industries use Stiripentol (CAS: 49763-96-4)?

Stiripentol (CAS: 49763-96-4) is primarily used in the pharmaceutical industry as an anticonvulsant ...

Compound Q&A

What precautions should be taken when handling Stiripentol (CAS: 49763-96-4)?

When handling Stiripentol (CAS: 49763-96-4), it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...