Compound Q&A

What are the physical and chemical properties of Protoporphyrin IX dimethylester (CAS: 5522-66-7)?

Answer

Protoporphyrin IX dimethylester
Protoporphyrin IX dimethylester (CAS: 5522-66-7) is a reddish-brown crystalline solid with a molecular weight of approximately 650.58 g/mol. It has a low solubility in water but is soluble in organic solvents such as methanol and ethanol. The compound is relatively stable but can react with certain metal ions. It is used in various applications due to its unique chemical properties.

About

CAS No 5522-66-7
English Name Protoporphyrin IX dimethylester
Molecular Formula C36H38N4O4
Molecular Weight 590.72 g/mol
EINECS 226-870-3
SMILES CC1=C2/C=C3C(C)=C(CCC(OC)=O)C(/C=C(N/4)/C(CCC(OC)=O)=C(C)C4=C\C5=N/C(C(C)=C5C=C)=C\C(N2)=C1C=C)=N/3
InChIKey WASRLAPXOHTNAX-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is Protoporphyrin IX dimethylester (CAS: 5522-66-7) typically synthesized?

Protoporphyrin IX dimethylester (CAS: 5522-66-7) is synthesized through a multistep process involvin...

Compound Q&A

What industries use Protoporphyrin IX dimethylester (CAS: 5522-66-7)?

Protoporphyrin IX dimethylester (CAS: 5522-66-7) is used in various industries. It is employed as a ...

Compound Q&A

What precautions should be taken when handling Protoporphyrin IX dimethylester (CAS: 5522-66-7)?

When handling Protoporphyrin IX dimethylester (CAS: 5522-66-7), it is important to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...