Compound Q&A

How is 1-Methoxy-1,1,3-trimethyl-3,3-diphenyldisiloxane (CAS: 68083-14-7) typically synthesized?

Answer

1-Methoxy-1,1,3-trimethyl-3,3-diphenyldisiloxane
1-Methoxy-1,1,3-trimethyl-3,3-diphenyldisiloxane is typically synthesized using a multistep process involving the reaction of a phenylsilane with methyltributyltin and methanol. The synthesis requires careful control of reaction conditions to ensure high yield and selectivity.

About

CAS No 68083-14-7
English Name 1-Methoxy-1,1,3-trimethyl-3,3-diphenyldisiloxane
Molecular Formula C16H22O2Si2
Molecular Weight 302.52 g/mol
SMILES CO[Si](C)(C)O[Si](C)(c1ccccc1)c2ccccc2
InChIKey ARWRSWALIGRKQA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Methoxy-1,1,3-trimethyl-3,3-diphenyldisiloxane (CAS: 68083-14-7)?

1-Methoxy-1,1,3-trimethyl-3,3-diphenyldisiloxane (CAS: 68083-14-7) is a colorless, viscous liquid wi...

Compound Q&A

What industries use 1-Methoxy-1,1,3-trimethyl-3,3-diphenyldisiloxane (CAS: 68083-14-7)?

1-Methoxy-1,1,3-trimethyl-3,3-diphenyldisiloxane (CAS: 68083-14-7) is used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 1-Methoxy-1,1,3-trimethyl-3,3-diphenyldisiloxane (CAS: 68083-14-7)?

When handling 1-Methoxy-1,1,3-trimethyl-3,3-diphenyldisiloxane (CAS: 68083-14-7), wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...