Compound Q&A

How is Aripiprazole Impurity 1 (CAS: 120004-79-7) typically synthesized?

Answer

Aripiprazole Impurity 1
Aripiprazole Impurity 1 is typically synthesized through a series of steps involving reactions such as amide formation, reduction, and cyclization. Catalysts like palladium and bases like potassium carbonate are often used. The synthesis involves multiple steps and requires careful temperature control to ensure selectivity and yield, typically around 80-90%. Detailed reaction conditions and purification methods are essential for obtaining high-purity impurity samples.

About

English Name Aripiprazole Impurity 1
Molecular Formula C13H16ClNO2
Molecular Weight 253.73 g/mol
SMILES C1CC(=O)NC2=C1C=CC(=C2)OCCCCCl
InChIKey SRMLSNBGMDJSJH-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aripiprazole Impurity 1 (CAS: 120004-79-7)?

Aripiprazole Impurity 1 is a white to off-white solid with a molecular weight of approximately 349.4...

Compound Q&A

What industries use Aripiprazole Impurity 1 (CAS: 120004-79-7)?

Aripiprazole Impurity 1 is primarily used in the pharmaceutical industry as an intermediate in the s...

Compound Q&A

What precautions should be taken when handling Aripiprazole Impurity 1 (CAS: 120004-79-7)?

When handling Aripiprazole Impurity 1 (CAS: 120004-79-7), it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...