Compound Q&A

What industries use 1,8-Bis(phenylsulfanyl)-9,10-anthraquinone (CAS: 13676-91-0)?

Answer

1,8-Bis(phenylsulfanyl)-9,10-anthraquinone
1,8-Bis(phenylsulfanyl)-9,10-anthraquinone (CAS: 13676-91-0) finds applications in various industries. It is used in the pharmaceutical sector for the development of certain dyes and pigments. It also has potential uses in sensor technology, where it can act as a sensitive material for detecting specific chemical species. Additionally, it is explored for its properties in semiconductor materials and as a precursor in the synthesis of other complex organic compounds.

About

CAS No 13676-91-0
English Name 1,8-Bis(phenylsulfanyl)-9,10-anthraquinone
Molecular Formula C26H16O2S2
Molecular Weight 424.55 g/mol
SMILES C1=CC=C(C=C1)SC2=CC=CC3=C2C(=O)C4=C(C3=O)C=CC=C4SC5=CC=CC=C5
InChIKey CNRPDCKHCGUKDK-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,8-Bis(phenylsulfanyl)-9,10-anthraquinone (CAS: 13676-91-0)?

1,8-Bis(phenylsulfanyl)-9,10-anthraquinone (CAS: 13676-91-0) is a crystalline compound with a molecu...

Compound Q&A

How is 1,8-Bis(phenylsulfanyl)-9,10-anthraquinone (CAS: 13676-91-0) typically synthesized?

1,8-Bis(phenylsulfanyl)-9,10-anthraquinone (CAS: 13676-91-0) is typically synthesized by the sequent...

Compound Q&A

What precautions should be taken when handling 1,8-Bis(phenylsulfanyl)-9,10-anthraquinone (CAS: 13676-91-0)?

When handling 1,8-Bis(phenylsulfanyl)-9,10-anthraquinone (CAS: 13676-91-0), it is essential to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...