Compound Q&A

What are the physical and chemical properties of N-[(Benzyloxy)carbonyl]phenylalanine (CAS: 2448-45-5)?

Answer

N-[(Benzyloxy)carbonyl]phenylalanine
N-[(Benzyloxy)carbonyl]phenylalanine (CAS: 2448-45-5) is a white crystalline solid with a molecular weight of approximately 314.31 g/mol. It is sparingly soluble in water but soluble in organic solvents like methanol and ethanol. The compound is known for its stability under normal conditions but can undergo hydrolysis in acidic or basic conditions. It is used as a building block in peptide synthesis and pharmaceuticals due to its reactivity and structural diversity.

About

CAS No 2448-45-5
English Name N-[(Benzyloxy)carbonyl]phenylalanine
Molecular Formula C17H17NO4
Molecular Weight 299.33 g/mol
SMILES C1=CC=C(C=C1)CC(C(=O)O)NC(=O)OCC2=CC=CC=C2
InChIKey RRONHWAVOYADJL-OAHLLOKOSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is N-[(Benzyloxy)carbonyl]phenylalanine (CAS: 2448-45-5) typically synthesized?

N-[(Benzyloxy)carbonyl]phenylalanine (CAS: 2448-45-5) is typically synthesized via a multistep proce...

Compound Q&A

What industries use N-[(Benzyloxy)carbonyl]phenylalanine (CAS: 2448-45-5)?

N-[(Benzyloxy)carbonyl]phenylalanine (CAS: 2448-45-5) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling N-[(Benzyloxy)carbonyl]phenylalanine (CAS: 2448-45-5)?

When handling N-[(Benzyloxy)carbonyl]phenylalanine (CAS: 2448-45-5), it is crucial to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...