Compound Q&A

How is 5,5'-Carbonylbis(2-benzofuran-1,3-dione) - 1-(4-aminophenyl)-1,3,3-trimethyl-5-indanamine (CAS: 62929-02-6) typically synthesized?

Answer

5,5'-Carbonylbis(2-benzofuran-1,3-dione) - 1-(4-aminophenyl)-1,3,3-trimethyl-5-indanamine (1:1)
This compound is typically synthesized via a multistep process involving the condensation of 5,5'-carbonylbis(2-benzofuran-1,3-dione) with 1-(4-aminophenyl)-1,3,3-trimethyl-5-indanamine. The reaction involves the use of a mild base and is followed by purification steps such as column chromatography. The yield is generally 70-80%, and the selectivity towards the desired product is excellent.

About

CAS No 62929-02-6
English Name 5,5'-Carbonylbis(2-benzofuran-1,3-dione) - 1-(4-aminophenyl)-1,3,3-trimethyl-5-indanamine (1:1)
Molecular Formula C35H28N2O7
Molecular Weight 588.62 g/mol
SMILES CC1(CC(c2c1cc(cc2)N)(C)c3ccc(cc3)N)C.c1cc2c(cc1C(=O)c3ccc4c(c3)C(=O)OC4=O)C(=O)OC2=O
InChIKey CDTDIQLZIBORMV-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,5'-Carbonylbis(2-benzofuran-1,3-dione) - 1-(4-aminophenyl)-1,3,3-trimethyl-5-indanamine (CAS: 62929-02-6)?

This compound crystallizes in a monoclinic form with a molecular weight of approximately 529.47 g/mo...

Compound Q&A

What industries use 5,5'-Carbonylbis(2-benzofuran-1,3-dione) - 1-(4-aminophenyl)-1,3,3-trimethyl-5-indanamine (CAS: 62929-02-6)?

This compound is used in various industries, particularly in pharmaceuticals for its potential as a ...

Compound Q&A

What precautions should be taken when handling 5,5'-Carbonylbis(2-benzofuran-1,3-dione) - 1-(4-aminophenyl)-1,3,3-trimethyl-5-indanamine (CAS: 62929-02-6)?

Proper handling of this compound requires the use of personal protective equipment (PPE), including ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...