Compound Q&A

What industries use 4-Bromo-1-nitro-2-(trifluoromethyl)benzene (CAS: 344-38-7)?

Answer

4-Bromo-1-nitro-2-(trifluoromethyl)benzene
4-Bromo-1-nitro-2-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synthesis of certain drug candidates. It is also relevant in the polymer industry for the development of specific monomers and polymers. Additionally, it can be utilized in the electronics industry for the production of semiconductor materials.

About

CAS No 344-38-7
English Name 4-Bromo-1-nitro-2-(trifluoromethyl)benzene
Molecular Formula C7H3BrF3NO2
Molecular Weight 270 g/mol
SMILES C1=CC(=C(C=C1Br)C(F)(F)F)[N+](=O)[O-]
InChIKey ZHLYHEDQTJZYFI-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-1-nitro-2-(trifluoromethyl)benzene (CAS: 344-38-7)?

4-Bromo-1-nitro-2-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 4-Bromo-1-nitro-2-(trifluoromethyl)benzene (CAS: 344-38-7) typically synthesized?

4-Bromo-1-nitro-2-(trifluoromethyl)benzene is often synthesized via the nitration of 2-(trifluoromet...

Compound Q&A

What precautions should be taken when handling 4-Bromo-1-nitro-2-(trifluoromethyl)benzene (CAS: 344-38-7)?

When handling 4-Bromo-1-nitro-2-(trifluoromethyl)benzene, it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...