Compound Q&A

How should Methyl 5-bromo-2-iodobenzoate (CAS: 181765-86-6) be stored?

Answer

Methyl 5-bromo-2-iodobenzoate
Methyl 5-bromo-2-iodobenzoate (CAS: 181765-86-6) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture and light exposure. Avoid storing it near incompatible materials such as reducing agents or strong oxidizing agents.

About

English Name Methyl 5-bromo-2-iodobenzoate
Molecular Formula C8H6BrIO2
Molecular Weight 340.94 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Br)I
InChIKey CJRHLSZJEFJDLA-UHFFFAOYSA-N
Last Updated: 2025-10-01 00:17

Related Q&A

Compound Q&A

What is Methyl 5-bromo-2-iodobenzoate (CAS: 181765-86-6)?

Methyl 5-bromo-2-iodobenzoate (CAS: 181765-86-6) is a chemical compound with a molecular formula of ...

Compound Q&A

What are the main uses of Methyl 5-bromo-2-iodobenzoate (CAS: 181765-86-6)?

Methyl 5-bromo-2-iodobenzoate (CAS: 181765-86-6) is primarily used in the synthesis of various pharm...

Compound Q&A

Is Methyl 5-bromo-2-iodobenzoate (CAS: 181765-86-6) safe?

Methyl 5-bromo-2-iodobenzoate (CAS: 181765-86-6) is not considered inherently hazardous, but it shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...