Compound Q&A

What is 3-(2-Sulfanylacetoxy)-2,2-bis[(2-sulfanylacetoxy)methyl]propyl sulfanylacetate (CAS: 10193-99-4)?

Answer

3-(2-Sulfanylacetoxy)-2,2-bis[(2-sulfanylacetoxy)methyl]propyl sulfanylacetate
3-(2-Sulfanylacetoxy)-2,2-bis[(2-sulfanylacetoxy)methyl]propyl sulfanylacetate is a complex organic compound with a molecular structure featuring multiple sulfur-containing functional groups. It is used in various applications including pharmaceuticals, research, and industry due to its unique chemical properties.

About

CAS No 10193-99-4
English Name 3-(2-Sulfanylacetoxy)-2,2-bis[(2-sulfanylacetoxy)methyl]propyl sulfanylacetate
Molecular Formula C13H20O8S4
Molecular Weight 432.56 g/mol
SMILES C(C(=O)OCC(COC(=O)CS)(COC(=O)CS)COC(=O)CS)S
InChIKey RUDUCNPHDIMQCY-UHFFFAOYSA-N
Last Updated: 2025-10-01 00:17

Related Q&A

Compound Q&A

What are the main uses of 3-(2-Sulfanylacetoxy)-2,2-bis[(2-sulfanylacetoxy)methyl]propyl sulfanylacetate (CAS: 10193-99-4)?

This compound is primarily used in pharmaceutical research for developing new drugs, as a reagent in...

Compound Q&A

Is 3-(2-Sulfanylacetoxy)-2,2-bis[(2-sulfanylacetoxy)methyl]propyl sulfanylacetate (CAS: 10193-99-4) safe?

The compound is generally considered safe for laboratory use when proper safety precautions are foll...

Compound Q&A

How should 3-(2-Sulfanylacetoxy)-2,2-bis[(2-sulfanylacetoxy)methyl]propyl sulfanylacetate (CAS: 10193-99-4) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...