Compound Q&A

How should N,N,N-Trimethyl-1-decanaminium chloride (CAS: 10108-87-9) be stored?

Answer

N,N,N-Trimethyl-1-decanaminium chloride
N,N,N-Trimethyl-1-decanaminium chloride should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly closed container to prevent moisture absorption. Ensure proper ventilation in the storage area to avoid the formation of hazardous gases.

About

CAS No 10108-87-9
English Name N,N,N-Trimethyl-1-decanaminium chloride
Molecular Formula C13H30ClN
Molecular Weight 235.84 g/mol
SMILES CCCCCCCCCC[N+](C)(C)C.[Cl-]
InChIKey HXWGXXDEYMNGCT-UHFFFAOYSA-M
Last Updated: 2025-10-01 00:17

Related Q&A

Compound Q&A

What is N,N,N-Trimethyl-1-decanaminium chloride (CAS: 10108-87-9)?

N,N,N-Trimethyl-1-decanaminium chloride is an organic compound with the CAS number 10108-87-9. It is...

Compound Q&A

What are the main uses of N,N,N-Trimethyl-1-decanaminium chloride (CAS: 10108-87-9)?

N,N,N-Trimethyl-1-decanaminium chloride is primarily used in pharmaceuticals as a surfactant and emu...

Compound Q&A

Is N,N,N-Trimethyl-1-decanaminium chloride (CAS: 10108-87-9) safe?

N,N,N-Trimethyl-1-decanaminium chloride is generally considered safe when used as directed. However,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...