Compound Q&A

How should Hexakis(2-methyl-2-phenylpropyl)distannoxane (CAS: 13356-08-6) be stored?

Answer

Hexakis(2-methyl-2-phenylpropyl)distannoxane
Hexakis(2-methyl-2-phenylpropyl)distannoxane (CAS: 13356-08-6) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. Avoid storing it near incompatible materials such as oxidizing agents.

About

CAS No 13356-08-6
English Name Hexakis(2-methyl-2-phenylpropyl)distannoxane
Molecular Formula C60H78OSn2
Molecular Weight 1052.7 g/mol
SMILES CC(C)(C[Sn](CC(C)(C)c1ccccc1)(CC(C)(C)c2ccccc2)O[Sn](CC(C)(C)c3ccccc3)(CC(C)(C)c4ccccc4)CC(C)(C)c5ccccc5)c6ccccc6
InChIKey HOXINJBQVZWYGZ-UHFFFAOYSA-N
Last Updated: 2025-09-30 08:42

Related Q&A

Compound Q&A

What is Hexakis(2-methyl-2-phenylpropyl)distannoxane (CAS: 13356-08-6)?

Hexakis(2-methyl-2-phenylpropyl)distannoxane (CAS: 13356-08-6) is a complex organostannane compound....

Compound Q&A

What are the main uses of Hexakis(2-methyl-2-phenylpropyl)distannoxane (CAS: 13356-08-6)?

Hexakis(2-methyl-2-phenylpropyl)distannoxane (CAS: 13356-08-6) is primarily used in organic synthesi...

Compound Q&A

Is Hexakis(2-methyl-2-phenylpropyl)distannoxane (CAS: 13356-08-6) safe?

Hexakis(2-methyl-2-phenylpropyl)distannoxane (CAS: 13356-08-6) is generally considered safe when han...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...