Compound Q&A

What is 2,9-Dichloro-1,10-phenanthroline (CAS: 29176-55-4)?

Answer

2,9-Dichloro-1,10-phenanthroline
2,9-Dichloro-1,10-phenanthroline is a chemical compound with a CAS number of 29176-55-4. It is a yellow crystalline solid with the molecular formula C14H6Cl2N2. This compound is used in various applications including analytical chemistry for redox titrations and as a ligand in coordination chemistry.

About

CAS No 29176-55-4
English Name 2,9-Dichloro-1,10-phenanthroline
Molecular Formula C12H6Cl2N2
Molecular Weight 249.1 g/mol
SMILES C1=CC2=C(C3=C1C=CC(=N3)Cl)N=C(C=C2)Cl
InChIKey DNKGIDURJINUOA-UHFFFAOYSA-N
Last Updated: 2025-09-30 08:42

Related Q&A

Compound Q&A

What are the main uses of 2,9-Dichloro-1,10-phenanthroline (CAS: 29176-55-4)?

2,9-Dichloro-1,10-phenanthroline is primarily used as a ligand in coordination chemistry for redox t...

Compound Q&A

Is 2,9-Dichloro-1,10-phenanthroline (CAS: 29176-55-4) safe?

2,9-Dichloro-1,10-phenanthroline is generally considered safe when handled with appropriate precauti...

Compound Q&A

How should 2,9-Dichloro-1,10-phenanthroline (CAS: 29176-55-4) be stored?

2,9-Dichloro-1,10-phenanthroline should be stored in a cool, dry place, away from heat and direct su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...