Compound Q&A

Are there alternatives to 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride (CAS: 141556-45-8) in synthesis?

Answer

1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride
Alternatives to 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride (CAS: 141556-45-8) include various imidazoles such as 1,2-dimethylimidazole or 1,2-diethylimidazole, which can serve similar functions in certain reactions depending on the specific application. Researchers often explore these options to find the most suitable reagent for their needs.

About

English Name 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride
Molecular Formula C21H27ClN2
Molecular Weight 340.9 g/mol
SMILES CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C3=C(C=C(C=C3C)C)C)C.[Cl-]
InChIKey COGMCBFILULEOS-UHFFFAOYSA-M
Last Updated: 2025-09-30 00:13

Related Q&A

Compound Q&A

What regulatory guidelines apply to 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride (CAS: 141556-45-8)?

The compound 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride (CAS: 141556-45-8) falls under the...

Compound Q&A

What is the market or research trend for 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride (CAS: 141556-45-8)?

Research trends for 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride (CAS: 141556-45-8) include ...

Compound Q&A

How should waste containing 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride (CAS: 141556-45-8) be handled?

Waste containing 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride (CAS: 141556-45-8) should be c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...