Compound Q&A

What are the physical and chemical properties of 2,6-Dichloroquinoline (CAS: 1810-72-6)?

Answer

2,6-Dichloroquinoline
2,6-Dichloroquinoline is a crystalline compound with a molecular weight of approximately 215.03 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable but can react with nucleophiles. It is commonly used in the synthesis of other compounds and in the development of new materials.

About

CAS No 1810-72-6
English Name 2,6-Dichloroquinoline
Molecular Formula C9H5Cl2N
Molecular Weight 198.05 g/mol
SMILES C1=CC2=C(C=CC(=N2)Cl)C=C1Cl
InChIKey LPDFGLZUUCLXGM-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 2,6-Dichloroquinoline (CAS: 1810-72-6) typically synthesized?

2,6-Dichloroquinoline is usually synthesized via the condensation of 2,6-dichloronitrobenzene with q...

Compound Q&A

What industries use 2,6-Dichloroquinoline (CAS: 1810-72-6)?

2,6-Dichloroquinoline finds applications in various industries. It is used in the pharmaceutical sec...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloroquinoline (CAS: 1810-72-6)?

When handling 2,6-Dichloroquinoline, it is important to wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...