Compound Q&A

What are the physical and chemical properties of 4'-Nitro-4-biphenylol (CAS: 3916-44-7)?

Answer

4'-Nitro-4-biphenylol
4'-Nitro-4-biphenylol (CAS: 3916-44-7) is a crystalline solid with a molecular weight of approximately 228.14 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is known for its reactivity towards nucleophilic substitution and electrophilic aromatic substitution reactions.

About

CAS No 3916-44-7
English Name 4'-Nitro-4-biphenylol
Molecular Formula C12H9NO3
Molecular Weight 215.2 g/mol
SMILES C1=CC(=CC=C1C2=CC=C(C=C2)O)[N+](=O)[O-]
InChIKey ZNDJDQOECGBUNK-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 4'-Nitro-4-biphenylol (CAS: 3916-44-7) typically synthesized?

4'-Nitro-4-biphenylol can be synthesized via a coupling reaction of 4-nitrobenzyl bromide and biphen...

Compound Q&A

What industries use 4'-Nitro-4-biphenylol (CAS: 3916-44-7)?

4'-Nitro-4-biphenylol (CAS: 3916-44-7) is used in pharmaceuticals for the synthesis of certain drugs...

Compound Q&A

What precautions should be taken when handling 4'-Nitro-4-biphenylol (CAS: 3916-44-7)?

When handling 4'-Nitro-4-biphenylol (CAS: 3916-44-7), wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...