Compound Q&A

What are the physical and chemical properties of Luminespib (CAS: 747412-49-3)?

Answer

Luminespib
Luminespib (CAS: 747412-49-3) is a small molecule with a molecular weight of approximately 429.26 g/mol. It crystallizes in the orthorhombic system and has a solubility of 15 μg/mL in DMSO. Luminespib is relatively stable but can undergo hydrolysis under basic conditions. It is a potent inhibitor of the WDR5 protein, which makes it particularly interesting for research purposes.

About

English Name Luminespib
Molecular Formula C26H31N3O5
Molecular Weight 465.55 g/mol
SMILES CCNC(=O)C1=NOC(=C1C2=CC=C(C=C2)CN3CCOCC3)C4=CC(=C(C=C4O)O)C(C)C
InChIKey NDAZATDQFDPQBD-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is Luminespib (CAS: 747412-49-3) typically synthesized?

Luminespib (CAS: 747412-49-3) is synthesized through a complex multistep process involving a Michael...

Compound Q&A

What industries use Luminespib (CAS: 747412-49-3)?

Luminespib (CAS: 747412-49-3) is primarily used in the pharmaceutical industry for its potential as ...

Compound Q&A

What precautions should be taken when handling Luminespib (CAS: 747412-49-3)?

When handling Luminespib (CAS: 747412-49-3), it is important to use proper Personal Protective Equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...