Compound Q&A

What are the physical and chemical properties of Cinobufotalin (CAS: 1108-68-5)?

Answer

Cinobufotalin
Cinobufotalin is a cyclic steroid alkaloid. It appears as a white or off-white crystalline powder. The molecular weight is approximately 468.44 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and methanol. Cinobufotalin is less reactive chemically but can undergo hydrolysis under basic conditions. It has a melting point of about 220-222°C.

About

CAS No 1108-68-5
English Name Cinobufotalin
Molecular Formula C26H34O7
Molecular Weight 458.5 g/mol
SMILES CC(=O)OC1C(C2(CCC3C(C24C1O4)CCC5(C3(CCC(C5)O)C)O)C)C6=COC(=O)C=C6
InChIKey KBKUJJFDSHBPPA-ZNCGZLKOSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is Cinobufotalin (CAS: 1108-68-5) typically synthesized?

Cinobufotalin is typically synthesized from the bufadienolide bufotalin using a series of reactions ...

Compound Q&A

What industries use Cinobufotalin (CAS: 1108-68-5)?

Cinobufotalin is primarily used in the pharmaceutical industry for its cardiotonic and antiarrhythmi...

Compound Q&A

What precautions should be taken when handling Cinobufotalin (CAS: 1108-68-5)?

When handling Cinobufotalin, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...