Compound Q&A

What industries use 2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide (CAS: 2512-29-0)?

Answer

2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide
2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide is primarily used in the pharmaceutical industry for its antioxidant and anti-inflammatory properties. It also finds applications in the development of sensors and as a precursor in the synthesis of other advanced materials. In the semiconductor industry, it is used as an intermediate in the production of certain organic semiconductors and as a dopant material.

About

CAS No 2512-29-0
English Name 2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide
Molecular Formula C17H16N4O4
Molecular Weight 340.33 g/mol
EINECS 219-730-8
SMILES Cc1ccc(c(c1)[N+](=O)[O-])N=NC(C(=O)C)C(=O)Nc2ccccc2
InChIKey MFYSUUPKMDJYPF-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide (CAS: 2512-29-0)?

2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide is a solid crystalline compound with a...

Compound Q&A

How is 2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide (CAS: 2512-29-0) typically synthesized?

2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide can be synthesized via diazotization o...

Compound Q&A

What precautions should be taken when handling 2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide (CAS: 2512-29-0)?

When handling 2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide (CAS: 2512-29-0), safety...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...