Compound Q&A

How is (R)-Benzyl 2-hydroxy-2-phenylacetate (CAS: 97415-09-3) typically synthesized?

Answer

(R)-Benzyl 2-hydroxy-2-phenylacetate
(R)-Benzyl 2-hydroxy-2-phenylacetate can be synthesized via a kinetic resolution of racemic benzyl 2-phenylacetate using chiral stationary phases or via asymmetric synthesis using chiral auxiliaries. The reaction conditions typically include the use of a chiral catalyst and a base like sodium hydroxide, leading to high enantiomeric excess and good yield.

About

CAS No 97415-09-3
English Name (R)-Benzyl 2-hydroxy-2-phenylacetate
Molecular Formula C15H14O3
Molecular Weight 242.27 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(C2=CC=CC=C2)O
InChIKey JFKWZVQEMSKSBU-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-Benzyl 2-hydroxy-2-phenylacetate (CAS: 97415-09-3)?

(R)-Benzyl 2-hydroxy-2-phenylacetate is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use (R)-Benzyl 2-hydroxy-2-phenylacetate (CAS: 97415-09-3)?

(R)-Benzyl 2-hydroxy-2-phenylacetate finds applications in the pharmaceutical industry as a chiral b...

Compound Q&A

What precautions should be taken when handling (R)-Benzyl 2-hydroxy-2-phenylacetate (CAS: 97415-09-3)?

When handling (R)-Benzyl 2-hydroxy-2-phenylacetate, wear appropriate personal protective equipment i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...