Compound Q&A

What are the physical and chemical properties of [(2R,3S,4R,5R,6S)-3,4,6-tris(acetyloxy)-5-acetamidooxan-2-yl]methyl acetate (CAS: 7772-79-4)?

Answer

[(2R,3S,4R,5R,6S)-3,4,6-tris(acetyloxy)-5-acetamidooxan-2-yl]methyl acetate
The compound [(2R,3S,4R,5R,6S)-3,4,6-tris(acetyloxy)-5-acetamidooxan-2-yl]methyl acetate is a white crystalline solid with a molecular weight of approximately 540.63 g/mol. It has a very low solubility in water but is soluble in common organic solvents such as ethanol and acetone. The compound is moderately reactive, showing some tendency for hydrolysis and ester interchange under basic conditions. It is stable under neutral and acidic conditions.

About

CAS No 7772-79-4
English Name [(2R,3S,4R,5R,6S)-3,4,6-tris(acetyloxy)-5-acetamidooxan-2-yl]methyl acetate
Molecular Formula C16H23NO10
Molecular Weight 389.36 g/mol
SMILES CC(=O)NC1C(C(C(OC1OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C
InChIKey OVPIZHVSWNOZMN-OXGONZEZSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is [(2R,3S,4R,5R,6S)-3,4,6-tris(acetyloxy)-5-acetamidooxan-2-yl]methyl acetate (CAS: 7772-79-4) typically synthesized?

[(2R,3S,4R,5R,6S)-3,4,6-tris(acetyloxy)-5-acetamidooxan-2-yl]methyl acetate is typically synthesized...

Compound Q&A

What industries use [(2R,3S,4R,5R,6S)-3,4,6-tris(acetyloxy)-5-acetamidooxan-2-yl]methyl acetate (CAS: 7772-79-4)?

This compound is primarily used in the pharmaceutical industry, where it serves as an intermediate i...

Compound Q&A

What precautions should be taken when handling [(2R,3S,4R,5R,6S)-3,4,6-tris(acetyloxy)-5-acetamidooxan-2-yl]methyl acetate (CAS: 7772-79-4)?

Proper handling of [(2R,3S,4R,5R,6S)-3,4,6-tris(acetyloxy)-5-acetamidooxan-2-yl]methyl acetate requi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...