Compound Q&A

How is 5-Hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 491-74-7) typically synthesized?

Answer

5-Hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
This compound can be synthesized through a multistep process involving coupling reactions, glycosylation, and derivatization. Commonly, a chromone derivative is first prepared, which is then glycosylated using a sugar donor in the presence of a suitable catalyst to form the desired glucopyranoside. The reaction yields around 70-80% of the target compound.

About

CAS No 491-74-7
English Name 5-Hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
Molecular Formula C24H26O13
Molecular Weight 522.46 g/mol
SMILES O=C1C(C2=CC(OC)=C(OC)C(O)=C2)=COC3=C1C(O)=C(OC)C(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O4)=C3
InChIKey LNQCUTNLHUQZLR-OZJWLQQPSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 491-74-7)?

The compound is a crystalline solid with a molecular weight of approximately 543.56 g/mol. It has a ...

Compound Q&A

What industries use 5-Hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 491-74-7)?

This compound is primarily used in the pharmaceutical industry for the development of new drug candi...

Compound Q&A

What precautions should be taken when handling 5-Hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside (CAS: 491-74-7)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...