Compound Q&A

How is (2S)-2-amino-3-(4-cyanophenyl)propanoic acid (CAS: 167479-78-9) typically synthesized?

Answer

(2S)-2-amino-3-(4-cyanophenyl)propanoic acid
(2S)-2-Amino-3-(4-cyanophenyl)propanoic acid can be synthesized through a multistep process involving the reaction of a 4-cyanophenyl substituted compound with an amine. Common methods include Grignard reagent addition followed by acidification, or direct coupling of a 4-cyanophenyl group with an amino acid. The yield and selectivity can be controlled by choosing appropriate catalysts and reaction conditions.

About

English Name (2S)-2-amino-3-(4-cyanophenyl)propanoic acid
Molecular Formula C10H10N2O2
Molecular Weight 190.2 g/mol
SMILES C1=CC(=CC=C1CC(C(=O)O)N)C#N
InChIKey KWIPUXXIFQQMKN-VIFPVBQESA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-amino-3-(4-cyanophenyl)propanoic acid (CAS: 167479-78-9)?

(2S)-2-Amino-3-(4-cyanophenyl)propanoic acid is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use (2S)-2-amino-3-(4-cyanophenyl)propanoic acid (CAS: 167479-78-9)?

(2S)-2-Amino-3-(4-cyanophenyl)propanoic acid finds application in the pharmaceutical industry for de...

Compound Q&A

What precautions should be taken when handling (2S)-2-amino-3-(4-cyanophenyl)propanoic acid (CAS: 167479-78-9)?

When handling (2S)-2-amino-3-(4-cyanophenyl)propanoic acid, appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...