Compound Q&A

What industries use Methyl 3-methyl-4-nitrobenzoate (CAS: 24078-21-5)?

Answer

Methyl 3-methyl-4-nitrobenzoate
Methyl 3-methyl-4-nitrobenzoate is used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs and in the polymer industry for the production of specific polymers. It is also utilized in the production of sensors and in the semiconductor industry for various applications.

About

CAS No 24078-21-5
English Name Methyl 3-methyl-4-nitrobenzoate
Molecular Formula C9H9NO4
Molecular Weight 195.17 g/mol
SMILES CC1=C(C=CC(=C1)C(=O)OC)[N+](=O)[O-]
InChIKey IEFONJKJLZFGKQ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-methyl-4-nitrobenzoate (CAS: 24078-21-5)?

Methyl 3-methyl-4-nitrobenzoate is a crystalline solid with a molecular weight of approximately 210....

Compound Q&A

How is Methyl 3-methyl-4-nitrobenzoate (CAS: 24078-21-5) typically synthesized?

Methyl 3-methyl-4-nitrobenzoate is typically synthesized by the nitration of 3-methylbenzoic acid fo...

Compound Q&A

What precautions should be taken when handling Methyl 3-methyl-4-nitrobenzoate (CAS: 24078-21-5)?

Handling Methyl 3-methyl-4-nitrobenzoate requires the use of personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...