Compound Q&A

How is Copper(2+) diperchlorate (CAS: 10294-46-9) typically synthesized?

Answer

Copper(2+) diperchlorate
Copper(2+) diperchlorate is typically synthesized by treating copper(II) chloride with concentrated perchloric acid. The process involves dissolving copper(II) chloride in concentrated perchloric acid, followed by crystallization to obtain the diperchlorate salt. This method provides good yield and selectivity.

About

CAS No 10294-46-9
English Name Copper(2+) diperchlorate
Molecular Formula Cl2CuO8
Molecular Weight 262.45 g/mol
SMILES [O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O.[Cu+2]
InChIKey YRNNKGFMTBWUGL-UHFFFAOYSA-L
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Copper(2+) diperchlorate (CAS: 10294-46-9)?

Copper(2+) diperchlorate is a crystalline solid with a molecular weight of approximately 261.44 g/mo...

Compound Q&A

What industries use Copper(2+) diperchlorate (CAS: 10294-46-9)?

Copper(2+) diperchlorate finds applications in various industries. It is used in analytical chemistr...

Compound Q&A

What precautions should be taken when handling Copper(2+) diperchlorate (CAS: 10294-46-9)?

When handling Copper(2+) diperchlorate, ensure proper personal protective equipment (PPE) is used, i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...