Compound Q&A

What are the physical and chemical properties of 2-Bromo-3-fluorobenzoic acid (CAS: 132715-69-6)?

Answer

2-Bromo-3-fluorobenzoic acid
2-Bromo-3-fluorobenzoic acid is a crystalline solid with a molecular weight of approximately 220.03 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. This compound exhibits moderate reactivity towards nucleophiles and is less reactive towards electrophiles. It has a melting point of around 184-186°C.

About

English Name 2-Bromo-3-fluorobenzoic acid
Molecular Formula C7H4BrFO2
Molecular Weight 219.009 g/mol
SMILES C1=CC(=C(C(=C1)F)Br)C(=O)O
InChIKey KQRCBMPPEPNNDS-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 2-Bromo-3-fluorobenzoic acid (CAS: 132715-69-6) typically synthesized?

2-Bromo-3-fluorobenzoic acid is typically synthesized through the bromination of 3-fluorobenzoic aci...

Compound Q&A

What industries use 2-Bromo-3-fluorobenzoic acid (CAS: 132715-69-6)?

2-Bromo-3-fluorobenzoic acid is used in the pharmaceutical industry for the synthesis of certain dru...

Compound Q&A

What precautions should be taken when handling 2-Bromo-3-fluorobenzoic acid (CAS: 132715-69-6)?

When handling 2-Bromo-3-fluorobenzoic acid, it is essential to wear appropriate personal protective ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...