Compound Q&A

What industries use Mertansine (CAS: 139504-50-0)?

Answer

Mertansine
Mertansine finds applications primarily in the pharmaceutical industry, where it is used as a precursor for anticancer drugs. It is also used in the development of imaging agents for diagnostics. Its properties make it valuable for research in areas such as drug discovery and biomedical imaging.

About

English Name Mertansine
Molecular Formula C35H48ClN3O10S
Molecular Weight 738.3 g/mol
SMILES C[C@@H]1[C@@H]2C[C@]([C@@H](/C=C/C=C(/Cc3cc(c(c(c3)OC)Cl)N(C(=O)C[C@@H]([C@]4([C@H]1O4)C)OC(=O)[C@H](C)N(C)C(=O)CCS)C)\C)OC)(NC(=O)O2)O
InChIKey ANZJBCHSOXCCRQ-FKUXLPTCSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mertansine (CAS: 139504-50-0)?

Mertansine is a crystalline compound with a molecular weight of approximately 332.36 g/mol. It is po...

Compound Q&A

How is Mertansine (CAS: 139504-50-0) typically synthesized?

Mertansine is synthesized through a multistep process involving key reactions such as amination and ...

Compound Q&A

What precautions should be taken when handling Mertansine (CAS: 139504-50-0)?

When handling Mertansine, it is important to wear appropriate personal protective equipment (PPE), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...