Compound Q&A

What industries use (+/-)-Epinephrine Hydrochloride (CAS: 329-63-5)?

Answer

(+/-)-Epinephrine Hydrochloride
(+/-)-Epinephrine Hydrochloride (CAS: 329-63-5) is primarily used in the pharmaceutical industry for its bronchodilatory and vasoconstrictive effects. It is also utilized in the food industry as a preservative and in the semiconductor industry for microelectronic applications. Additionally, it is used in the polymer industry as a crosslinking agent and in biosensors for detection of various analytes.

About

CAS No 329-63-5
English Name (+/-)-Epinephrine Hydrochloride
Molecular Formula C9H14ClNO3
Molecular Weight 219.67 g/mol
SMILES CNCC(C1=CC(=C(C=C1)O)O)O.Cl
InChIKey ATADHKWKHYVBTJ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+/-)-Epinephrine Hydrochloride (CAS: 329-63-5)?

Catecholamine in nature, (+/-)-Epinephrine Hydrochloride (CAS: 329-63-5) has a molecular weight of 2...

Compound Q&A

How is (+/-)-Epinephrine Hydrochloride (CAS: 329-63-5) typically synthesized?

The synthesis of (+/-)-Epinephrine Hydrochloride (CAS: 329-63-5) usually involves the asymmetric syn...

Compound Q&A

What precautions should be taken when handling (+/-)-Epinephrine Hydrochloride (CAS: 329-63-5)?

Proper handling of (+/-)-Epinephrine Hydrochloride (CAS: 329-63-5) requires the use of personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...