Compound Q&A

How is 2,6-Dibromoanthracene (CAS: 186517-01-1) typically synthesized?

Answer

2,6-Dibromoanthracene
2,6-Dibromoanthracene (CAS: 186517-01-1) can be synthesized by bromination of anthracene using N-bromosuccinimide (NBS) or bromine in the presence of a Lewis acid like aluminum chloride. The reaction is typically performed under an inert atmosphere to prevent side reactions. The product can be purified by recrystallization or column chromatography.

About

English Name 2,6-Dibromoanthracene
Molecular Formula C14H8Br2
Molecular Weight 336.03 g/mol
SMILES C1=CC(=CC2=CC3=C(C=C21)C=C(C=C3)Br)Br
InChIKey BPRGLVVFWRNXEP-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dibromoanthracene (CAS: 186517-01-1)?

2,6-Dibromoanthracene (CAS: 186517-01-1) is a solid with a crystalline form. Its molecular weight is...

Compound Q&A

What industries use 2,6-Dibromoanthracene (CAS: 186517-01-1)?

2,6-Dibromoanthracene (CAS: 186517-01-1) is used in pharmaceuticals for developing photoactive compo...

Compound Q&A

What precautions should be taken when handling 2,6-Dibromoanthracene (CAS: 186517-01-1)?

When handling 2,6-Dibromoanthracene (CAS: 186517-01-1), it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...