Compound Q&A

What are the physical and chemical properties of Ethyl 2-(diethoxyphosphoryl)propanoate (CAS: 3699-66-9)?

Answer

Ethyl 2-(diethoxyphosphoryl)propanoate
Ethyl 2-(diethoxyphosphoryl)propanoate (CAS: 3699-66-9) is a colorless to slightly yellowish liquid with a molecular weight of approximately 269.25 g/mol. It has a high boiling point of around 210°C and is poorly soluble in water but miscible with common organic solvents. The compound is moderately reactive due to the presence of the phosphoryl group, which can participate in various chemical reactions.

About

CAS No 3699-66-9
English Name Ethyl 2-(diethoxyphosphoryl)propanoate
Molecular Formula C9H19O5P
Molecular Weight 238.22 g/mol
SMILES CCOC(=O)C(C)P(=O)(OCC)OCC
InChIKey BVSRWCMAJISCTD-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is Ethyl 2-(diethoxyphosphoryl)propanoate (CAS: 3699-66-9) typically synthesized?

Ethyl 2-(diethoxyphosphoryl)propanoate (CAS: 3699-66-9) is typically synthesized by the reaction of ...

Compound Q&A

What industries use Ethyl 2-(diethoxyphosphoryl)propanoate (CAS: 3699-66-9)?

Ethyl 2-(diethoxyphosphoryl)propanoate (CAS: 3699-66-9) is used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(diethoxyphosphoryl)propanoate (CAS: 3699-66-9)?

When handling Ethyl 2-(diethoxyphosphoryl)propanoate (CAS: 3699-66-9), appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...