Compound Q&A

What industries use 4-Chloro-3-(chlorosulfonyl)benzoic acid (CAS: 2494-79-3)?

Answer

4-Chloro-3-(chlorosulfonyl)benzoic acid
4-Chloro-3-(chlorosulfonyl)benzoic acid (CAS: 2494-79-3) finds applications in the pharmaceutical industry for the synthesis of certain active pharmaceutical ingredients. It is also used in the polymer industry for the development of functional polymers. Additionally, it can be used in sensor technology and semiconductor manufacturing for specific chemical processes.

About

CAS No 2494-79-3
English Name 4-Chloro-3-(chlorosulfonyl)benzoic acid
Molecular Formula C7H4Cl2O4S
Molecular Weight 255.08 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)S(=O)(=O)Cl)Cl
InChIKey LYBQQYNSZYSUMT-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-3-(chlorosulfonyl)benzoic acid (CAS: 2494-79-3)?

4-Chloro-3-(chlorosulfonyl)benzoic acid (CAS: 2494-79-3) is a crystalline solid with a molecular wei...

Compound Q&A

How is 4-Chloro-3-(chlorosulfonyl)benzoic acid (CAS: 2494-79-3) typically synthesized?

4-Chloro-3-(chlorosulfonyl)benzoic acid (CAS: 2494-79-3) is typically synthesized via the chlorosulf...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3-(chlorosulfonyl)benzoic acid (CAS: 2494-79-3)?

When handling 4-Chloro-3-(chlorosulfonyl)benzoic acid (CAS: 2494-79-3), it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...